C14H24N2O3 — CID 122569551
[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-piperidin-4-ylmethanone (PubChem CID 122569551) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-piperidin-4-ylmethanone.
| Compound Name | [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 122569551 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-piperidin-4-ylmethanone |
| SMILES | O=C(C1CCNCC1)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C14H24N2O3/c17-12-5-10-7-16(8-11(10)6-13(12)18)14(19)9-1-3-15-4-2-9/h9-13,15,17-18H,1-8H2/t10-,11+,12-,13-/m0/s1 |
| InChIKey | CECWOONQEBVBHK-RNJOBUHISA-N |
| XLogP | -0.42 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |