C15H26N2O3 — CID 131949254
1-[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-piperidin-4-ylethanone (PubChem CID 131949254) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-piperidin-4-ylethanone.
| Compound Name | 1-[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 131949254 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-piperidin-4-ylethanone |
| SMILES | O=C(CC1CCNCC1)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C15H26N2O3/c18-13-6-11-8-17(9-12(11)7-14(13)19)15(20)5-10-1-3-16-4-2-10/h10-14,16,18-19H,1-9H2/t11-,12+,13-,14-/m0/s1 |
| InChIKey | VFSGJPSFZRVMQF-CRWXNKLISA-N |
| XLogP | -0.03 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |