C18H23N3O3 — CID 122570370
(4aS,7aS)-6-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 122570370) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (4aS,7aS)-6-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 122570370 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (4aS,7aS)-6-[[2-(3-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | COc1cccc(-c2nc(CN3C[C@@H]4NCCO[C@H]4C3)c(C)o2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-12-15(9-21-10-16-17(11-21)23-7-6-19-16)20-18(24-12)13-4-3-5-14(8-13)22-2/h3-5,8,16-17,19H,6-7,9-11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | LLRCZZPMHCPVQH-IRXDYDNUSA-N |
| XLogP | 1.83 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |