C16H19F2N3O2 — CID 122570706
3-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-ethyl-N-(2-hydroxyethyl)benzamide (PubChem CID 122570706) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is 3-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-ethyl-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-ethyl-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 122570706 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-[1-(difluoromethyl)-5-methylpyrazol-4-yl]-N-ethyl-N-(2-hydroxyethyl)benzamide |
| SMILES | CCN(CCO)C(=O)c1cccc(-c2cnn(C(F)F)c2C)c1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-3-20(7-8-22)15(23)13-6-4-5-12(9-13)14-10-19-21(11(14)2)16(17)18/h4-6,9-10,16,22H,3,7-8H2,1-2H3 |
| InChIKey | HWFIUAMUENNYSX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |