C13H21N5 — CID 122572379
(1S,2R,6S,7R)-10-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 122572379) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is (1S,2R,6S,7R)-10-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2R,6S,7R)-10-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 122572379 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (1S,2R,6S,7R)-10-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | Cc1nncn1CCN1[C@@H]2CC[C@H]1[C@H]1CNC[C@H]12 |
| InChI | InChI=1S/C13H21N5/c1-9-16-15-8-17(9)4-5-18-12-2-3-13(18)11-7-14-6-10(11)12/h8,10-14H,2-7H2,1H3/t10-,11+,12-,13+ |
| InChIKey | NKQKRGIESWPBFS-MPZDIEGVSA-N |
| XLogP | 0.27 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |