C9H15NO5 — CID 122573790
dimethyl 3-hydroxypiperidine-1,4-dicarboxylate (PubChem CID 122573790) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is dimethyl 3-hydroxypiperidine-1,4-dicarboxylate.
| Compound Name | dimethyl 3-hydroxypiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 122573790 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | dimethyl 3-hydroxypiperidine-1,4-dicarboxylate |
| SMILES | COC(=O)C1CCN(C(=O)OC)CC1O |
| InChI | InChI=1S/C9H15NO5/c1-14-8(12)6-3-4-10(5-7(6)11)9(13)15-2/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | SOWUXORVXIBXNF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |