C9H15NO3 — CID 15778473
methyl (3S,4R)-3-ethenyl-4-hydroxypiperidine-1-carboxylate (PubChem CID 15778473) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl (3S,4R)-3-ethenyl-4-hydroxypiperidine-1-carboxylate.
| Compound Name | methyl (3S,4R)-3-ethenyl-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 15778473 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl (3S,4R)-3-ethenyl-4-hydroxypiperidine-1-carboxylate |
| SMILES | C=C[C@H]1CN(C(=O)OC)CC[C@H]1O |
| InChI | InChI=1S/C9H15NO3/c1-3-7-6-10(9(12)13-2)5-4-8(7)11/h3,7-8,11H,1,4-6H2,2H3/t7-,8+/m0/s1 |
| InChIKey | CEHYTZOJKJWXQN-JGVFFNPUSA-N |
| XLogP | 0.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|