C12H11F3O — CID 122575514
4-[4-(trifluoromethyl)phenyl]pent-1-yn-3-ol (PubChem CID 122575514) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]pent-1-yn-3-ol.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]pent-1-yn-3-ol |
|---|---|
| PubChem CID | 122575514 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]pent-1-yn-3-ol |
| SMILES | C#CC(O)C(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O/c1-3-11(16)8(2)9-4-6-10(7-5-9)12(13,14)15/h1,4-8,11,16H,2H3 |
| InChIKey | AUZWTRSGXHBWGF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|