C33H58O — CID 122575695
(3S,10S,13R)-3-(3,3-dimethylbut-1-en-2-yloxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 122575695) has the molecular formula C33H58O and a molecular weight of 470.83 g/mol. Its IUPAC name is (3S,10S,13R)-3-(3,3-dimethylbut-1-en-2-yloxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,10S,13R)-3-(3,3-dimethylbut-1-en-2-yloxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 122575695 |
| Molecular Formula | C33H58O |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.45 |
| IUPAC Name | (3S,10S,13R)-3-(3,3-dimethylbut-1-en-2-yloxy)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(O[C@H]1CC[C@@]2(C)C(CCC3C2CC[C@@]2(C)C3CCC2[C@H](C)CCCC(C)C)C1)C(C)(C)C |
| InChI | InChI=1S/C33H58O/c1-22(2)11-10-12-23(3)28-15-16-29-27-14-13-25-21-26(34-24(4)31(5,6)7)17-19-32(25,8)30(27)18-20-33(28,29)9/h22-23,25-30H,4,10-21H2,1-3,5-9H3/t23-,25?,26+,27?,28?,29?,30?,32+,33-/m1/s1 |
| InChIKey | SIDWIZGLQJANNG-HHBOTJOMSA-N |
| XLogP | 10.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|