C29H50OS2 — CID 134880826
O-[(10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methylsulfanylmethanethioate (PubChem CID 134880826) has the molecular formula C29H50OS2 and a molecular weight of 478.85 g/mol. Its IUPAC name is O-[(10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 134880826 |
| Molecular Formula | C29H50OS2 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | O-[(10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)OC1CC[C@@]2(C)C(CCC3C4CCC(C(C)CCCC(C)C)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C29H50OS2/c1-19(2)8-7-9-20(3)24-12-13-25-23-11-10-21-18-22(30-27(31)32-6)14-16-28(21,4)26(23)15-17-29(24,25)5/h19-26H,7-18H2,1-6H3/t20?,21?,22?,23?,24?,25?,26?,28-,29+/m0/s1 |
| InChIKey | ABWRTQKOKFBTFA-SDEHVBLXSA-N |
| XLogP | 9.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|