C33H16N4S — CID 122575971
9-[2-cyano-6-(8-cyanodibenzothiophen-2-yl)phenyl]carbazole-3-carbonitrile (PubChem CID 122575971) has the molecular formula C33H16N4S and a molecular weight of 500.59 g/mol. Its IUPAC name is 9-[2-cyano-6-(8-cyanodibenzothiophen-2-yl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[2-cyano-6-(8-cyanodibenzothiophen-2-yl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 122575971 |
| Molecular Formula | C33H16N4S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 9-[2-cyano-6-(8-cyanodibenzothiophen-2-yl)phenyl]carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2sc3ccc(-c4cccc(C#N)c4-n4c5ccccc5c5cc(C#N)ccc54)cc3c2c1 |
| InChI | InChI=1S/C33H16N4S/c34-17-20-8-11-30-26(14-20)25-5-1-2-7-29(25)37(30)33-23(19-36)4-3-6-24(33)22-10-13-32-28(16-22)27-15-21(18-35)9-12-31(27)38-32/h1-16H |
| InChIKey | JXMWFEZNWOXARS-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |