C44H23N3S2 — CID 153462821
2-carbazol-9-yl-3-[18-(4-isocyanophenyl)-10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaen-6-yl]benzonitrile (PubChem CID 153462821) has the molecular formula C44H23N3S2 and a molecular weight of 657.82 g/mol. Its IUPAC name is 2-carbazol-9-yl-3-[18-(4-isocyanophenyl)-10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaen-6-yl]benzonitrile.
| Compound Name | 2-carbazol-9-yl-3-[18-(4-isocyanophenyl)-10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaen-6-yl]benzonitrile |
|---|---|
| PubChem CID | 153462821 |
| Molecular Formula | C44H23N3S2 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.13 |
| IUPAC Name | 2-carbazol-9-yl-3-[18-(4-isocyanophenyl)-10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaen-6-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3sc4cc5sc6ccc(-c7cccc(C#N)c7-n7c8ccccc8c8ccccc87)cc6c5cc4c3c2)cc1 |
| InChI | InChI=1S/C44H23N3S2/c1-46-30-17-13-26(14-18-30)27-15-19-40-34(21-27)36-23-37-35-22-28(16-20-41(35)49-43(37)24-42(36)48-40)31-10-6-7-29(25-45)44(31)47-38-11-4-2-8-32(38)33-9-3-5-12-39(33)47/h2-24H |
| InChIKey | KXDRGTQKKWUEGV-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|