C23H15N5O3 — CID 122582105
5-[(4R)-8-ethynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole (PubChem CID 122582105) has the molecular formula C23H15N5O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is 5-[(4R)-8-ethynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole.
| Compound Name | 5-[(4R)-8-ethynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 122582105 |
| Molecular Formula | C23H15N5O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[(4R)-8-ethynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1[N+](=O)[O-])=N[C@H](C)c1c(-c3cnco3)ncn1-2 |
| InChI | InChI=1S/C23H15N5O3/c1-3-15-8-9-18-17(10-15)21(16-6-4-5-7-19(16)28(29)30)26-14(2)23-22(25-12-27(18)23)20-11-24-13-31-20/h1,4-14H,2H3/t14-/m1/s1 |
| InChIKey | UMJYADPTKPDFMK-CQSZACIVSA-N |
| XLogP | 4.33 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|