C23H17BrN4O3 — CID 134309536
(4R)-8-bromo-4-methyl-3-(3-methylfuran-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 134309536) has the molecular formula C23H17BrN4O3 and a molecular weight of 477.32 g/mol. Its IUPAC name is (4R)-8-bromo-4-methyl-3-(3-methylfuran-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine.
| Compound Name | (4R)-8-bromo-4-methyl-3-(3-methylfuran-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 134309536 |
| Molecular Formula | C23H17BrN4O3 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (4R)-8-bromo-4-methyl-3-(3-methylfuran-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | Cc1ccoc1-c1ncn2c1[C@@H](C)N=C(c1ccccc1[N+](=O)[O-])c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C23H17BrN4O3/c1-13-9-10-31-23(13)21-22-14(2)26-20(16-5-3-4-6-19(16)28(29)30)17-11-15(24)7-8-18(17)27(22)12-25-21/h3-12,14H,1-2H3/t14-/m1/s1 |
| InChIKey | VIAKJMPYCNBJER-CQSZACIVSA-N |
| XLogP | 6.02 |
| TPSA | 86.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|