C15H12BrN3O2 — CID 60646142
1-(4-bromo-2-nitrophenyl)-5,6-dimethylbenzimidazole (PubChem CID 60646142) has the molecular formula C15H12BrN3O2 and a molecular weight of 346.18 g/mol. Its IUPAC name is 1-(4-bromo-2-nitrophenyl)-5,6-dimethylbenzimidazole.
| Compound Name | 1-(4-bromo-2-nitrophenyl)-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 60646142 |
| Molecular Formula | C15H12BrN3O2 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 1-(4-bromo-2-nitrophenyl)-5,6-dimethylbenzimidazole |
| SMILES | Cc1cc2ncn(-c3ccc(Br)cc3[N+](=O)[O-])c2cc1C |
| InChI | InChI=1S/C15H12BrN3O2/c1-9-5-12-14(6-10(9)2)18(8-17-12)13-4-3-11(16)7-15(13)19(20)21/h3-8H,1-2H3 |
| InChIKey | BWPWKLOTDWODNN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|