C12H11BrN4O3 — CID 64781574
1-(4-bromo-2-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide (PubChem CID 64781574) has the molecular formula C12H11BrN4O3 and a molecular weight of 339.15 g/mol. Its IUPAC name is 1-(4-bromo-2-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-(4-bromo-2-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 64781574 |
| Molecular Formula | C12H11BrN4O3 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1-(4-bromo-2-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccn(-c2ccc(Br)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H11BrN4O3/c1-15(2)12(18)9-5-6-16(14-9)10-4-3-8(13)7-11(10)17(19)20/h3-7H,1-2H3 |
| InChIKey | IHTDYJCMFZNZEP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|