C12H13BrN4O — CID 65342316
1-(2-amino-5-bromophenyl)-N,N-dimethylpyrazole-3-carboxamide (PubChem CID 65342316) has the molecular formula C12H13BrN4O and a molecular weight of 309.17 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenyl)-N,N-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-(2-amino-5-bromophenyl)-N,N-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65342316 |
| Molecular Formula | C12H13BrN4O |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-(2-amino-5-bromophenyl)-N,N-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccn(-c2cc(Br)ccc2N)n1 |
| InChI | InChI=1S/C12H13BrN4O/c1-16(2)12(18)10-5-6-17(15-10)11-7-8(13)3-4-9(11)14/h3-7H,14H2,1-2H3 |
| InChIKey | QQDVMKSTBGXLPM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|