C13H12N4O4 — CID 64782674
1-(2-formyl-4-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide (PubChem CID 64782674) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 1-(2-formyl-4-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-(2-formyl-4-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 64782674 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-(2-formyl-4-nitrophenyl)-N,N-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccn(-c2ccc([N+](=O)[O-])cc2C=O)n1 |
| InChI | InChI=1S/C13H12N4O4/c1-15(2)13(19)11-5-6-16(14-11)12-4-3-10(17(20)21)7-9(12)8-18/h3-8H,1-2H3 |
| InChIKey | DUZNBCNUJPTCJP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|