C11H12N2O4S — CID 114234657
2-(2-formyl-4-nitrophenyl)sulfanyl-N,N-dimethylacetamide (PubChem CID 114234657) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-(2-formyl-4-nitrophenyl)sulfanyl-N,N-dimethylacetamide.
| Compound Name | 2-(2-formyl-4-nitrophenyl)sulfanyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114234657 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(2-formyl-4-nitrophenyl)sulfanyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSc1ccc([N+](=O)[O-])cc1C=O |
| InChI | InChI=1S/C11H12N2O4S/c1-12(2)11(15)7-18-10-4-3-9(13(16)17)5-8(10)6-14/h3-6H,7H2,1-2H3 |
| InChIKey | ZPJZQACLEAYLDA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|