C24H29N5O4 — CID 122584777
tert-butyl 4-[1-[[4-(hydroxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate (PubChem CID 122584777) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is tert-butyl 4-[1-[[4-(hydroxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[[4-(hydroxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122584777 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | tert-butyl 4-[1-[[4-(hydroxycarbamoyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc3c(ccn3Cc3ccc(C(=O)NO)cc3)c2)CC1 |
| InChI | InChI=1S/C24H29N5O4/c1-24(2,3)33-23(31)28-12-10-27(11-13-28)20-14-19-8-9-29(21(19)25-15-20)16-17-4-6-18(7-5-17)22(30)26-32/h4-9,14-15,32H,10-13,16H2,1-3H3,(H,26,30) |
| InChIKey | KOKBXRAOGCQXPP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|