C22H28FN5O3 — CID 122585020
(2R)-2-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-6-fluorohexan-1-ol (PubChem CID 122585020) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is (2R)-2-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-6-fluorohexan-1-ol.
| Compound Name | (2R)-2-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-6-fluorohexan-1-ol |
|---|---|
| PubChem CID | 122585020 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (2R)-2-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-6-fluorohexan-1-ol |
| SMILES | COc1ccc(CNc2nc(N[C@@H](CO)CCCCF)c3ncccc3n2)c(OC)c1 |
| InChI | InChI=1S/C22H28FN5O3/c1-30-17-9-8-15(19(12-17)31-2)13-25-22-27-18-7-5-11-24-20(18)21(28-22)26-16(14-29)6-3-4-10-23/h5,7-9,11-12,16,29H,3-4,6,10,13-14H2,1-2H3,(H2,25,26,27,28)/t16-/m1/s1 |
| InChIKey | KZMXPMXOPYYUHD-MRXNPFEDSA-N |
| XLogP | 3.57 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|