About 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine
4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine (PubChem CID 122588813) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine.
Molecular Properties
| Compound Name | 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine |
| PubChem CID | 122588813 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine |
| SMILES | Cn1cnc(C23CC(C4CCNCC4)(C2)C3)n1 |
| InChI | InChI=1S/C13H20N4/c1-17-9-15-11(16-17)13-6-12(7-13,8-13)10-2-4-14-5-3-10/h9-10,14H,2-8H2,1H3 |
| InChIKey | ZCFWMAMMSBBQEW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine?
The IUPAC name of 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine (CID 122588813) is 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine.
What is the SMILES notation for 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine?
The canonical SMILES for 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine is Cn1cnc(C23CC(C4CCNCC4)(C2)C3)n1.
What is the InChIKey of 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine?
The InChIKey is ZCFWMAMMSBBQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4/c1-17-9-15-11(16-17)13-6-12(7-13,8-13)10-2-4-14-5-3-10/h9-10,14H,2-8H2,1H3.
What are the key properties of 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine?
4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine has a molecular weight of 232.33 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1-methyl-1,2,4-triazol-3-yl)-1-bicyclo[1.1.1]pentanyl]piperidine is sourced from PubChem (CID 122588813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).