C24H30ClN3O2S+2 — CID 122590288
2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene (PubChem CID 122590288) has the molecular formula C24H30ClN3O2S+2 and a molecular weight of 460.04 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene.
| Compound Name | 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 122590288 |
| Molecular Formula | C24H30ClN3O2S+2 |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide;7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
| SMILES | COC[C@H](C)N(C(=O)CCl)c1c(C)csc1C.c1cc[n+]2c(c1)-c1cccc[n+]1CC2 |
| InChI | InChI=1S/C12H18ClNO2S.C12H12N2/c1-8-7-17-10(3)12(8)14(11(15)5-13)9(2)6-16-4;1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1/h7,9H,5-6H2,1-4H3;1-8H,9-10H2/q;+2/t9-;/m0./s1 |
| InChIKey | CURYECNSERRWCX-FVGYRXGTSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|