C16H16N4OS — CID 122590394
N-[(3R,4S)-1-cyano-4-methylpyrrolidin-3-yl]-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 122590394) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[(3R,4S)-1-cyano-4-methylpyrrolidin-3-yl]-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(3R,4S)-1-cyano-4-methylpyrrolidin-3-yl]-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122590394 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[(3R,4S)-1-cyano-4-methylpyrrolidin-3-yl]-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | C[C@H]1CN(C#N)C[C@@H]1NC(=O)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H16N4OS/c1-11-8-20(10-17)9-13(11)19-15(21)14-7-18-16(22-14)12-5-3-2-4-6-12/h2-7,11,13H,8-9H2,1H3,(H,19,21)/t11-,13-/m0/s1 |
| InChIKey | WEGYNUFPKWBDSC-AAEUAGOBSA-N |
| XLogP | 2.34 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|