C18H23N3OS — CID 164619567
2-phenyl-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 164619567) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-phenyl-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-phenyl-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164619567 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-phenyl-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H23N3OS/c22-17(19-10-7-13-21-11-5-2-6-12-21)16-14-20-18(23-16)15-8-3-1-4-9-15/h1,3-4,8-9,14H,2,5-7,10-13H2,(H,19,22) |
| InChIKey | LIOBUEJWVJSGIO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|