C17H15N3OS — CID 84507995
N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]pyridine-3-carboxamide (PubChem CID 84507995) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84507995 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1csc(-c2ccccc2)n1)c1cccnc1 |
| InChI | InChI=1S/C17H15N3OS/c21-16(14-7-4-9-18-11-14)19-10-8-15-12-22-17(20-15)13-5-2-1-3-6-13/h1-7,9,11-12H,8,10H2,(H,19,21) |
| InChIKey | QZLYHTFNTNXSMR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |