C15H13ClN4O2S — CID 122590938
2-(2-chlorophenyl)-N-[(3S,4S)-1-cyano-4-hydroxypyrrolidin-3-yl]-1,3-thiazole-5-carboxamide (PubChem CID 122590938) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[(3S,4S)-1-cyano-4-hydroxypyrrolidin-3-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[(3S,4S)-1-cyano-4-hydroxypyrrolidin-3-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122590938 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[(3S,4S)-1-cyano-4-hydroxypyrrolidin-3-yl]-1,3-thiazole-5-carboxamide |
| SMILES | N#CN1C[C@H](NC(=O)c2cnc(-c3ccccc3Cl)s2)[C@@H](O)C1 |
| InChI | InChI=1S/C15H13ClN4O2S/c16-10-4-2-1-3-9(10)15-18-5-13(23-15)14(22)19-11-6-20(8-17)7-12(11)21/h1-5,11-12,21H,6-7H2,(H,19,22)/t11-,12-/m0/s1 |
| InChIKey | YKUNAJANYQMMRN-RYUDHWBXSA-N |
| XLogP | 1.72 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|