C18H25F2N3O9 — CID 122591398
2-[[2-[(2,2-difluoroacetyl)amino]-2-methyl-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]carbonylamino]ethyl prop-2-enoate (PubChem CID 122591398) has the molecular formula C18H25F2N3O9 and a molecular weight of 465.41 g/mol. Its IUPAC name is 2-[[2-[(2,2-difluoroacetyl)amino]-2-methyl-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]carbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-[(2,2-difluoroacetyl)amino]-2-methyl-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]carbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 122591398 |
| Molecular Formula | C18H25F2N3O9 |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[[2-[(2,2-difluoroacetyl)amino]-2-methyl-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propoxy]carbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCC(C)(COC(=O)NCCOC(=O)C=C)NC(=O)C(F)F |
| InChI | InChI=1S/C18H25F2N3O9/c1-4-12(24)29-8-6-21-16(27)31-10-18(3,23-15(26)14(19)20)11-32-17(28)22-7-9-30-13(25)5-2/h4-5,14H,1-2,6-11H2,3H3,(H,21,27)(H,22,28)(H,23,26) |
| InChIKey | HYABDDNAGFEMPQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|