C10H15FN2O5 — CID 89417478
2-[2-[(2-fluoroacetyl)amino]ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 89417478) has the molecular formula C10H15FN2O5 and a molecular weight of 262.24 g/mol. Its IUPAC name is 2-[2-[(2-fluoroacetyl)amino]ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[(2-fluoroacetyl)amino]ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89417478 |
| Molecular Formula | C10H15FN2O5 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[2-[(2-fluoroacetyl)amino]ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCNC(=O)CF |
| InChI | InChI=1S/C10H15FN2O5/c1-2-9(15)17-5-4-13-10(16)18-6-3-12-8(14)7-11/h2H,1,3-7H2,(H,12,14)(H,13,16) |
| InChIKey | AJIBVJVNQFNXGK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|