C9H15NO4 — CID 19799335
2-(propan-2-yloxycarbonylamino)ethyl prop-2-enoate (PubChem CID 19799335) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(propan-2-yloxycarbonylamino)ethyl prop-2-enoate.
| Compound Name | 2-(propan-2-yloxycarbonylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 19799335 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(propan-2-yloxycarbonylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OC(C)C |
| InChI | InChI=1S/C9H15NO4/c1-4-8(11)13-6-5-10-9(12)14-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,10,12) |
| InChIKey | AICKFUBKDWOPRD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|