C9H12F3NO4 — CID 88879039
2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl prop-2-enoate (PubChem CID 88879039) has the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. Its IUPAC name is 2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 88879039 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO4/c1-2-7(14)17-6-5-16-4-3-13-8(15)9(10,11)12/h2H,1,3-6H2,(H,13,15) |
| InChIKey | JOBPJELNXNTJOD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|