C12H12F6N2O6 — CID 55355525
bis[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-but-2-enedioate (PubChem CID 55355525) has the molecular formula C12H12F6N2O6 and a molecular weight of 394.22 g/mol. Its IUPAC name is bis[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-but-2-enedioate.
| Compound Name | bis[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 55355525 |
| Molecular Formula | C12H12F6N2O6 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | bis[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-but-2-enedioate |
| SMILES | O=C(COC(=O)/C=C/C(=O)OCC(=O)NCC(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C12H12F6N2O6/c13-11(14,15)5-19-7(21)3-25-9(23)1-2-10(24)26-4-8(22)20-6-12(16,17)18/h1-2H,3-6H2,(H,19,21)(H,20,22)/b2-1+ |
| InChIKey | WOUKKCNEUHMGNP-OWOJBTEDSA-N |
| XLogP | -0.01 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|