C9H8F7NO3 — CID 87599157
2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl prop-2-enoate (PubChem CID 87599157) has the molecular formula C9H8F7NO3 and a molecular weight of 311.15 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl prop-2-enoate.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 87599157 |
| Molecular Formula | C9H8F7NO3 |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F7NO3/c1-2-5(18)20-4-3-17-6(19)7(10,11)8(12,13)9(14,15)16/h2H,1,3-4H2,(H,17,19) |
| InChIKey | KBWMQLGAOGSNJH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|