C19H29N3 — CID 122591929
(Z,4E)-3-N-methyl-4-propylidene-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-1-ene-1,3,5-triamine (PubChem CID 122591929) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (Z,4E)-3-N-methyl-4-propylidene-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-1-ene-1,3,5-triamine.
| Compound Name | (Z,4E)-3-N-methyl-4-propylidene-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-1-ene-1,3,5-triamine |
|---|---|
| PubChem CID | 122591929 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (Z,4E)-3-N-methyl-4-propylidene-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-1-ene-1,3,5-triamine |
| SMILES | CC/C=C(\CN)C(/C=C(\N)C1CCCc2ccccc21)NC |
| InChI | InChI=1S/C19H29N3/c1-3-7-15(13-20)19(22-2)12-18(21)17-11-6-9-14-8-4-5-10-16(14)17/h4-5,7-8,10,12,17,19,22H,3,6,9,11,13,20-21H2,1-2H3/b15-7+,18-12- |
| InChIKey | IDVFYZWBAPYUHI-HVWYQZKLSA-N |
| XLogP | 2.83 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|