C25H25ClN4O2 — CID 122592465
1-[(2E,4Z)-3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]hepta-2,4,6-trienyl]-3-phenylurea (PubChem CID 122592465) has the molecular formula C25H25ClN4O2 and a molecular weight of 448.95 g/mol. Its IUPAC name is 1-[(2E,4Z)-3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]hepta-2,4,6-trienyl]-3-phenylurea.
| Compound Name | 1-[(2E,4Z)-3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]hepta-2,4,6-trienyl]-3-phenylurea |
|---|---|
| PubChem CID | 122592465 |
| Molecular Formula | C25H25ClN4O2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[(2E,4Z)-3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]hepta-2,4,6-trienyl]-3-phenylurea |
| SMILES | C=C/C=C(CCOc1ccccc1-c1cnc[nH]1)\C(Cl)=C/CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H25ClN4O2/c1-2-8-19(22(26)13-15-28-25(31)30-20-9-4-3-5-10-20)14-16-32-24-12-7-6-11-21(24)23-17-27-18-29-23/h2-13,17-18H,1,14-16H2,(H,27,29)(H2,28,30,31)/b19-8-,22-13+ |
| InChIKey | ODYVDSNRXIINCQ-QBAWZIBUSA-N |
| XLogP | 5.90 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|