C30H33F3O3 — CID 122594488
2,2,2-trifluoroethyl 6-(4-hydroxyphenyl)-2,2-dimethyl-4,4-diphenyloctanoate (PubChem CID 122594488) has the molecular formula C30H33F3O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 6-(4-hydroxyphenyl)-2,2-dimethyl-4,4-diphenyloctanoate.
| Compound Name | 2,2,2-trifluoroethyl 6-(4-hydroxyphenyl)-2,2-dimethyl-4,4-diphenyloctanoate |
|---|---|
| PubChem CID | 122594488 |
| Molecular Formula | C30H33F3O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2,2,2-trifluoroethyl 6-(4-hydroxyphenyl)-2,2-dimethyl-4,4-diphenyloctanoate |
| SMILES | CCC(CC(CC(C)(C)C(=O)OCC(F)(F)F)(c1ccccc1)c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H33F3O3/c1-4-22(23-15-17-26(34)18-16-23)19-29(24-11-7-5-8-12-24,25-13-9-6-10-14-25)20-28(2,3)27(35)36-21-30(31,32)33/h5-18,22,34H,4,19-21H2,1-3H3 |
| InChIKey | GKIKEANGVCBNJI-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |