C28H39NO5 — CID 122595231
cyclopent-3-en-1-yl (2S)-1-[(2S)-2-cyclohexyl-2-(3,4-dimethoxy-5-methylphenyl)acetyl]piperidine-2-carboxylate (PubChem CID 122595231) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is cyclopent-3-en-1-yl (2S)-1-[(2S)-2-cyclohexyl-2-(3,4-dimethoxy-5-methylphenyl)acetyl]piperidine-2-carboxylate.
| Compound Name | cyclopent-3-en-1-yl (2S)-1-[(2S)-2-cyclohexyl-2-(3,4-dimethoxy-5-methylphenyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 122595231 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | cyclopent-3-en-1-yl (2S)-1-[(2S)-2-cyclohexyl-2-(3,4-dimethoxy-5-methylphenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COc1cc([C@@H](C(=O)N2CCCC[C@H]2C(=O)OC2CC=CC2)C2CCCCC2)cc(C)c1OC |
| InChI | InChI=1S/C28H39NO5/c1-19-17-21(18-24(32-2)26(19)33-3)25(20-11-5-4-6-12-20)27(30)29-16-10-9-15-23(29)28(31)34-22-13-7-8-14-22/h7-8,17-18,20,22-23,25H,4-6,9-16H2,1-3H3/t23-,25-/m0/s1 |
| InChIKey | ULDNZAIFYDCIRY-ZCYQVOJMSA-N |
| XLogP | 5.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|