C28H41NO7 — CID 163204279
(2S)-1-[(2S)-2-cyclohexyl-2-[3,4-dimethoxy-5-(3-prop-2-enoxypropoxy)phenyl]acetyl]piperidine-2-carboxylic acid (PubChem CID 163204279) has the molecular formula C28H41NO7 and a molecular weight of 503.64 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-cyclohexyl-2-[3,4-dimethoxy-5-(3-prop-2-enoxypropoxy)phenyl]acetyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-cyclohexyl-2-[3,4-dimethoxy-5-(3-prop-2-enoxypropoxy)phenyl]acetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 163204279 |
| Molecular Formula | C28H41NO7 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | (2S)-1-[(2S)-2-cyclohexyl-2-[3,4-dimethoxy-5-(3-prop-2-enoxypropoxy)phenyl]acetyl]piperidine-2-carboxylic acid |
| SMILES | C=CCOCCCOc1cc([C@@H](C(=O)N2CCCC[C@H]2C(=O)O)C2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C28H41NO7/c1-4-15-35-16-10-17-36-24-19-21(18-23(33-2)26(24)34-3)25(20-11-6-5-7-12-20)27(30)29-14-9-8-13-22(29)28(31)32/h4,18-20,22,25H,1,5-17H2,2-3H3,(H,31,32)/t22-,25-/m0/s1 |
| InChIKey | PWGLHTRVKIDFLG-DHLKQENFSA-N |
| XLogP | 4.80 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|