C39H28N2 — CID 122595599
9-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 122595599) has the molecular formula C39H28N2 and a molecular weight of 527.69 g/mol. Its IUPAC name is 9-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 122595599 |
| Molecular Formula | C39H28N2 |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 9-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | [2H]C([2H])([2H])C1(C)c2ccccc2-c2ccc(-n3c4ccccc4c4c5c6ccccc6n(-c6ccccc6)c5ccc43)cc21 |
| InChI | InChI=1S/C39H28N2/c1-39(2)31-17-9-6-14-27(31)28-21-20-26(24-32(28)39)41-34-19-11-8-16-30(34)38-36(41)23-22-35-37(38)29-15-7-10-18-33(29)40(35)25-12-4-3-5-13-25/h3-24H,1-2H3/i1D3 |
| InChIKey | SMCDLCNTMKFPIX-FIBGUPNXSA-N |
| XLogP | 10.19 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |