C46H32N2 — CID 122595603
9-(9H-fluoren-3-yl)-14-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 122595603) has the molecular formula C46H32N2 and a molecular weight of 615.79 g/mol. Its IUPAC name is 9-(9H-fluoren-3-yl)-14-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9-(9H-fluoren-3-yl)-14-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 122595603 |
| Molecular Formula | C46H32N2 |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | 9-(9H-fluoren-3-yl)-14-[9-methyl-9-(trideuteriomethyl)fluoren-2-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | [2H]C([2H])([2H])C1(C)c2ccccc2-c2ccc(-n3c4ccccc4c4c5c6ccccc6n(-c6ccc7c(c6)-c6ccccc6C7)c5ccc43)cc21 |
| InChI | InChI=1S/C46H32N2/c1-46(2)38-16-8-5-13-33(38)34-22-21-31(27-39(34)46)48-41-18-10-7-15-36(41)45-43(48)24-23-42-44(45)35-14-6-9-17-40(35)47(42)30-20-19-29-25-28-11-3-4-12-32(28)37(29)26-30/h3-24,26-27H,25H2,1-2H3/i1D3 |
| InChIKey | GUGNEXXOMHJEDP-FIBGUPNXSA-N |
| XLogP | 11.76 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |