C28H26N2O2S — CID 122600535
(6S)-1,6-dibenzyl-4-(5-methyl-1-benzothiophene-2-carbonyl)piperazin-2-one (PubChem CID 122600535) has the molecular formula C28H26N2O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is (6S)-1,6-dibenzyl-4-(5-methyl-1-benzothiophene-2-carbonyl)piperazin-2-one.
| Compound Name | (6S)-1,6-dibenzyl-4-(5-methyl-1-benzothiophene-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 122600535 |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (6S)-1,6-dibenzyl-4-(5-methyl-1-benzothiophene-2-carbonyl)piperazin-2-one |
| SMILES | Cc1ccc2sc(C(=O)N3CC(=O)N(Cc4ccccc4)[C@@H](Cc4ccccc4)C3)cc2c1 |
| InChI | InChI=1S/C28H26N2O2S/c1-20-12-13-25-23(14-20)16-26(33-25)28(32)29-18-24(15-21-8-4-2-5-9-21)30(27(31)19-29)17-22-10-6-3-7-11-22/h2-14,16,24H,15,17-19H2,1H3/t24-/m0/s1 |
| InChIKey | OKAHBDQRMJNAMK-DEOSSOPVSA-N |
| XLogP | 5.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |