C27H39N9O9 — CID 122601537
2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-6-(2,4-dinitroanilino)hexanoic acid (PubChem CID 122601537) has the molecular formula C27H39N9O9 and a molecular weight of 633.66 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-6-(2,4-dinitroanilino)hexanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-6-(2,4-dinitroanilino)hexanoic acid |
|---|---|
| PubChem CID | 122601537 |
| Molecular Formula | C27H39N9O9 |
| Molecular Weight | 633.66 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-6-(2,4-dinitroanilino)hexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(C)N)C(=O)NC(CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C27H39N9O9/c1-15(2)10-21(34-26(39)22(33-24(37)16(3)28)11-17-13-29-14-31-17)25(38)32-20(27(40)41)6-4-5-9-30-19-8-7-18(35(42)43)12-23(19)36(44)45/h7-8,12-16,20-22,30H,4-6,9-11,28H2,1-3H3,(H,29,31)(H,32,38)(H,33,37)(H,34,39)(H,40,41) |
| InChIKey | PRTWPXNZZRXQNU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 277.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.66 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|