C9H17NO5S — CID 122604404
tert-butyl 5-(methoxymethyl)-2-oxooxathiazolidine-3-carboxylate (PubChem CID 122604404) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is tert-butyl 5-(methoxymethyl)-2-oxooxathiazolidine-3-carboxylate.
| Compound Name | tert-butyl 5-(methoxymethyl)-2-oxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 122604404 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | tert-butyl 5-(methoxymethyl)-2-oxooxathiazolidine-3-carboxylate |
| SMILES | COCC1CN(C(=O)OC(C)(C)C)S(=O)O1 |
| InChI | InChI=1S/C9H17NO5S/c1-9(2,3)14-8(11)10-5-7(6-13-4)15-16(10)12/h7H,5-6H2,1-4H3 |
| InChIKey | WUAFMXMQNQDLQI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |