C14H17ClN2O — CID 122604981
(S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol (PubChem CID 122604981) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol.
| Compound Name | (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol |
|---|---|
| PubChem CID | 122604981 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol |
| SMILES | O[C@H](c1cc(Cl)cc2cncn12)C1CCCCC1 |
| InChI | InChI=1S/C14H17ClN2O/c15-11-6-12-8-16-9-17(12)13(7-11)14(18)10-4-2-1-3-5-10/h6-10,14,18H,1-5H2/t14-/m0/s1 |
| InChIKey | AVJCRIIDMDBAQC-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |