About (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol
(S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol (PubChem CID 122604981) has the molecular formula C14H17ClN2O
and a molecular weight of 264.76 g/mol. Its IUPAC name is (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol.
Molecular Properties
| Compound Name | (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol |
| PubChem CID | 122604981 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol |
| SMILES | O[C@H](c1cc(Cl)cc2cncn12)C1CCCCC1 |
| InChI | InChI=1S/C14H17ClN2O/c15-11-6-12-8-16-9-17(12)13(7-11)14(18)10-4-2-1-3-5-10/h6-10,14,18H,1-5H2/t14-/m0/s1 |
| InChIKey | AVJCRIIDMDBAQC-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol?
The IUPAC name of (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol (CID 122604981) is (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol.
What is the SMILES notation for (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol?
The canonical SMILES for (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol is O[C@H](c1cc(Cl)cc2cncn12)C1CCCCC1.
What is the InChIKey of (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol?
The InChIKey is AVJCRIIDMDBAQC-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H17ClN2O/c15-11-6-12-8-16-9-17(12)13(7-11)14(18)10-4-2-1-3-5-10/h6-10,14,18H,1-5H2/t14-/m0/s1.
What are the key properties of (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol?
(S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol has a molecular weight of 264.76 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(7-chloroimidazo[1,5-a]pyridin-5-yl)-cyclohexylmethanol is sourced from PubChem (CID 122604981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).