C20H18N4 — CID 122608917
1-tert-butyl-6-(5-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzimidazole (PubChem CID 122608917) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-tert-butyl-6-(5-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzimidazole.
| Compound Name | 1-tert-butyl-6-(5-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzimidazole |
|---|---|
| PubChem CID | 122608917 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-tert-butyl-6-(5-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzimidazole |
| SMILES | C#Cc1cnc2[nH]cc(-c3ccc4ncn(C(C)(C)C)c4c3)c2c1 |
| InChI | InChI=1S/C20H18N4/c1-5-13-8-15-16(11-22-19(15)21-10-13)14-6-7-17-18(9-14)24(12-23-17)20(2,3)4/h1,6-12H,2-4H3,(H,21,22) |
| InChIKey | UDPOFVPBOUXZSM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|