C27H28N6S — CID 122671466
2-[3-[7-(3-tert-butylbenzimidazol-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]thiazinane (PubChem CID 122671466) has the molecular formula C27H28N6S and a molecular weight of 468.63 g/mol. Its IUPAC name is 2-[3-[7-(3-tert-butylbenzimidazol-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]thiazinane.
| Compound Name | 2-[3-[7-(3-tert-butylbenzimidazol-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]thiazinane |
|---|---|
| PubChem CID | 122671466 |
| Molecular Formula | C27H28N6S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[3-[7-(3-tert-butylbenzimidazol-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]thiazinane |
| SMILES | CC(C)(C)n1cnc2ccc(-c3c[nH]c4ncc(-c5cccc(N6CCCCS6)c5)nc34)cc21 |
| InChI | InChI=1S/C27H28N6S/c1-27(2,3)32-17-30-22-10-9-18(14-24(22)32)21-15-28-26-25(21)31-23(16-29-26)19-7-6-8-20(13-19)33-11-4-5-12-34-33/h6-10,13-17H,4-5,11-12H2,1-3H3,(H,28,29) |
| InChIKey | NNWUVWMIFZZLLQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|