C14H17IN2O — CID 122609554
cyclohexyl-(6-iodoimidazo[1,5-a]pyridin-5-yl)methanol (PubChem CID 122609554) has the molecular formula C14H17IN2O and a molecular weight of 356.21 g/mol. Its IUPAC name is cyclohexyl-(6-iodoimidazo[1,5-a]pyridin-5-yl)methanol.
| Compound Name | cyclohexyl-(6-iodoimidazo[1,5-a]pyridin-5-yl)methanol |
|---|---|
| PubChem CID | 122609554 |
| Molecular Formula | C14H17IN2O |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | cyclohexyl-(6-iodoimidazo[1,5-a]pyridin-5-yl)methanol |
| SMILES | OC(c1c(I)ccc2cncn12)C1CCCCC1 |
| InChI | InChI=1S/C14H17IN2O/c15-12-7-6-11-8-16-9-17(11)13(12)14(18)10-4-2-1-3-5-10/h6-10,14,18H,1-5H2 |
| InChIKey | UBUZEVSPQOXVHM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|