C16H18N2OS — CID 134343800
cyclohexyl-[6-(2-sulfanylethynyl)imidazo[1,5-a]pyridin-5-yl]methanol (PubChem CID 134343800) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is cyclohexyl-[6-(2-sulfanylethynyl)imidazo[1,5-a]pyridin-5-yl]methanol.
| Compound Name | cyclohexyl-[6-(2-sulfanylethynyl)imidazo[1,5-a]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 134343800 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | cyclohexyl-[6-(2-sulfanylethynyl)imidazo[1,5-a]pyridin-5-yl]methanol |
| SMILES | OC(c1c(C#CS)ccc2cncn12)C1CCCCC1 |
| InChI | InChI=1S/C16H18N2OS/c19-16(13-4-2-1-3-5-13)15-12(8-9-20)6-7-14-10-17-11-18(14)15/h6-7,10-11,13,16,19-20H,1-5H2 |
| InChIKey | PHINUTUBTMLZIL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|