About 2,4-dichloropentane
2,4-dichloropentane (PubChem CID 12261) has the molecular formula C5H10Cl2
and a molecular weight of 141.04 g/mol. Its IUPAC name is 2,4-dichloropentane.
Molecular Properties
| Compound Name | 2,4-dichloropentane |
| PubChem CID | 12261 |
| Molecular Formula | C5H10Cl2 |
| Molecular Weight | 141.04 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 2,4-dichloropentane |
| SMILES | CC(Cl)CC(C)Cl |
| InChI | InChI=1S/C5H10Cl2/c1-4(6)3-5(2)7/h4-5H,3H2,1-2H3 |
| InChIKey | DYGOBGYJRRKFEN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.04 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloropentane?
The IUPAC name of 2,4-dichloropentane (CID 12261) is 2,4-dichloropentane.
What is the SMILES notation for 2,4-dichloropentane?
The canonical SMILES for 2,4-dichloropentane is CC(Cl)CC(C)Cl.
What is the InChIKey of 2,4-dichloropentane?
The InChIKey is DYGOBGYJRRKFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Cl2/c1-4(6)3-5(2)7/h4-5H,3H2,1-2H3.
What are the key properties of 2,4-dichloropentane?
2,4-dichloropentane has a molecular weight of 141.04 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloropentane is sourced from PubChem (CID 12261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).