C21H24FN3O2 — CID 122615010
(6-fluoro-3-pyridinyl)-[4-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]methanone (PubChem CID 122615010) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl)-[4-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]methanone.
| Compound Name | (6-fluoro-3-pyridinyl)-[4-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122615010 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (6-fluoro-3-pyridinyl)-[4-(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc2c(c1)CCN(C1CCN(C(=O)c3ccc(F)nc3)CC1)C2 |
| InChI | InChI=1S/C21H24FN3O2/c1-27-19-4-2-17-14-25(9-6-15(17)12-19)18-7-10-24(11-8-18)21(26)16-3-5-20(22)23-13-16/h2-5,12-13,18H,6-11,14H2,1H3 |
| InChIKey | XPGFYOLJCGLPGY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|